C36H36N4 — CID 102173117
2,3-bis(4-tert-butylphenyl)-5,8-bis(1H-pyrrol-2-yl)quinoxaline (PubChem CID 102173117) has the molecular formula C36H36N4 and a molecular weight of 524.71 g/mol. Its IUPAC name is 2,3-bis(4-tert-butylphenyl)-5,8-bis(1H-pyrrol-2-yl)quinoxaline.
| Compound Name | 2,3-bis(4-tert-butylphenyl)-5,8-bis(1H-pyrrol-2-yl)quinoxaline |
|---|---|
| PubChem CID | 102173117 |
| Molecular Formula | C36H36N4 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 2,3-bis(4-tert-butylphenyl)-5,8-bis(1H-pyrrol-2-yl)quinoxaline |
| SMILES | CC(C)(C)c1ccc(-c2nc3c(-c4ccc[nH]4)ccc(-c4ccc[nH]4)c3nc2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H36N4/c1-35(2,3)25-15-11-23(12-16-25)31-32(24-13-17-26(18-14-24)36(4,5)6)40-34-28(30-10-8-22-38-30)20-19-27(33(34)39-31)29-9-7-21-37-29/h7-22,37-38H,1-6H3 |
| InChIKey | WQIXDNHDTVIBAL-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |