C37H42B2O4S — CID 102177877
2-[4,4-bis(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[1,2-b]thiophen-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102177877) has the molecular formula C37H42B2O4S and a molecular weight of 604.43 g/mol. Its IUPAC name is 2-[4,4-bis(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[1,2-b]thiophen-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4,4-bis(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[1,2-b]thiophen-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102177877 |
| Molecular Formula | C37H42B2O4S |
| Molecular Weight | 604.43 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 2-[4,4-bis(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[1,2-b]thiophen-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3-c3sc(B4OC(C)(C)C(C)(C)O4)cc32)cc1 |
| InChI | InChI=1S/C37H42B2O4S/c1-23-11-15-25(16-12-23)37(26-17-13-24(2)14-18-26)29-20-19-27(38-40-33(3,4)34(5,6)41-38)21-28(29)32-30(37)22-31(44-32)39-42-35(7,8)36(9,10)43-39/h11-22H,1-10H3 |
| InChIKey | CHYUKKQOVQOFND-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.43 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|