C50H49NO7 — CID 102178780
benzyl (2S,3S,4S,5R)-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]-5-phenacyl-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate (PubChem CID 102178780) has the molecular formula C50H49NO7 and a molecular weight of 775.94 g/mol. Its IUPAC name is benzyl (2S,3S,4S,5R)-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]-5-phenacyl-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3S,4S,5R)-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]-5-phenacyl-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102178780 |
| Molecular Formula | C50H49NO7 |
| Molecular Weight | 775.94 g/mol |
| Exact Mass | 775.35 |
| IUPAC Name | benzyl (2S,3S,4S,5R)-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]-5-phenacyl-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate |
| SMILES | O=C(C[C@@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]([C@@H](COCc2ccccc2)OCc2ccccc2)N1C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H49NO7/c52-45(43-29-17-6-18-30-43)31-44-48(56-34-40-23-11-3-12-24-40)49(57-35-41-25-13-4-14-26-41)47(51(44)50(53)58-36-42-27-15-5-16-28-42)46(55-33-39-21-9-2-10-22-39)37-54-32-38-19-7-1-8-20-38/h1-30,44,46-49H,31-37H2/t44-,46-,47+,48+,49+/m1/s1 |
| InChIKey | YZTUECBJEGXODR-QBTBBBLZSA-N |
| XLogP | 9.62 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.94 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |