C34H27BF2N4 — CID 102184376
4-(2,2-difluoro-4,10,12-triphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-6-yl)-N,N-dimethylaniline (PubChem CID 102184376) has the molecular formula C34H27BF2N4 and a molecular weight of 540.43 g/mol. Its IUPAC name is 4-(2,2-difluoro-4,10,12-triphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-6-yl)-N,N-dimethylaniline.
| Compound Name | 4-(2,2-difluoro-4,10,12-triphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-6-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 102184376 |
| Molecular Formula | C34H27BF2N4 |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 4-(2,2-difluoro-4,10,12-triphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-6-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2cc(-c3ccccc3)n3c2N=C2C(c4ccccc4)=CC(c4ccccc4)=[N+]2[B-]3(F)F)cc1 |
| InChI | InChI=1S/C34H27BF2N4/c1-39(2)28-20-18-25(19-21-28)30-23-32(27-16-10-5-11-17-27)41-34(30)38-33-29(24-12-6-3-7-13-24)22-31(40(33)35(41,36)37)26-14-8-4-9-15-26/h3-23H,1-2H3 |
| InChIKey | NWEPHDBKKJQCLF-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 23.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|