C26H33NO3Si — CID 102189163
(4S)-3-[(1Z)-1-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 102189163) has the molecular formula C26H33NO3Si and a molecular weight of 435.64 g/mol. Its IUPAC name is (4S)-3-[(1Z)-1-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(1Z)-1-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102189163 |
| Molecular Formula | C26H33NO3Si |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (4S)-3-[(1Z)-1-[tert-butyl(diphenyl)silyl]oxybuta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C/C=C(\O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C26H33NO3Si/c1-7-14-24(27-23(20(2)3)19-29-25(27)28)30-31(26(4,5)6,21-15-10-8-11-16-21)22-17-12-9-13-18-22/h7-18,20,23H,1,19H2,2-6H3/b24-14-/t23-/m1/s1 |
| InChIKey | SXNKUSMKRQVYAB-UOAMGUFGSA-N |
| XLogP | 5.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|