C18H17Cl2N — CID 102189407
10-butyl-1,8-dichloro-9-methylideneacridine (PubChem CID 102189407) has the molecular formula C18H17Cl2N and a molecular weight of 318.25 g/mol. Its IUPAC name is 10-butyl-1,8-dichloro-9-methylideneacridine.
| Compound Name | 10-butyl-1,8-dichloro-9-methylideneacridine |
|---|---|
| PubChem CID | 102189407 |
| Molecular Formula | C18H17Cl2N |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 10-butyl-1,8-dichloro-9-methylideneacridine |
| SMILES | C=C1c2c(Cl)cccc2N(CCCC)c2cccc(Cl)c21 |
| InChI | InChI=1S/C18H17Cl2N/c1-3-4-11-21-15-9-5-7-13(19)17(15)12(2)18-14(20)8-6-10-16(18)21/h5-10H,2-4,11H2,1H3 |
| InChIKey | ANWUFEKTVQIEHP-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |