C12H15NSe — CID 23558512
3-butyl-2-methylidene-1,3-benzoselenazole (PubChem CID 23558512) has the molecular formula C12H15NSe and a molecular weight of 252.22 g/mol. Its IUPAC name is 3-butyl-2-methylidene-1,3-benzoselenazole.
| Compound Name | 3-butyl-2-methylidene-1,3-benzoselenazole |
|---|---|
| PubChem CID | 23558512 |
| Molecular Formula | C12H15NSe |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 3-butyl-2-methylidene-1,3-benzoselenazole |
| SMILES | C=C1[Se]c2ccccc2N1CCCC |
| InChI | InChI=1S/C12H15NSe/c1-3-4-9-13-10(2)14-12-8-6-5-7-11(12)13/h5-8H,2-4,9H2,1H3 |
| InChIKey | RKOBNIWEFRHGBQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|