C28H13Br10NO4 — CID 102193174
1,2,3,4,5-pentabromo-6-[[4-[(E)-2-(4-nitrophenyl)ethenyl]-2-[(2,3,4,5,6-pentabromophenyl)methoxy]phenoxy]methyl]benzene (PubChem CID 102193174) has the molecular formula C28H13Br10NO4 and a molecular weight of 1226.45 g/mol. Its IUPAC name is 1,2,3,4,5-pentabromo-6-[[4-[(E)-2-(4-nitrophenyl)ethenyl]-2-[(2,3,4,5,6-pentabromophenyl)methoxy]phenoxy]methyl]benzene.
| Compound Name | 1,2,3,4,5-pentabromo-6-[[4-[(E)-2-(4-nitrophenyl)ethenyl]-2-[(2,3,4,5,6-pentabromophenyl)methoxy]phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 102193174 |
| Molecular Formula | C28H13Br10NO4 |
| Molecular Weight | 1226.45 g/mol |
| Exact Mass | 1216.27 |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-[[4-[(E)-2-(4-nitrophenyl)ethenyl]-2-[(2,3,4,5,6-pentabromophenyl)methoxy]phenoxy]methyl]benzene |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2ccc(OCc3c(Br)c(Br)c(Br)c(Br)c3Br)c(OCc3c(Br)c(Br)c(Br)c(Br)c3Br)c2)cc1 |
| InChI | InChI=1S/C28H13Br10NO4/c29-19-15(20(30)24(34)27(37)23(19)33)10-42-17-8-5-13(2-1-12-3-6-14(7-4-12)39(40)41)9-18(17)43-11-16-21(31)25(35)28(38)26(36)22(16)32/h1-9H,10-11H2/b2-1+ |
| InChIKey | OKSRGFPVZSRVPM-OWOJBTEDSA-N |
| XLogP | 14.55 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1226.45 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|