C26H32N2O2 — CID 102199068
4-[2,5-bis[(2S)-2-methylbutoxy]-4-pyridin-4-ylphenyl]pyridine (PubChem CID 102199068) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is 4-[2,5-bis[(2S)-2-methylbutoxy]-4-pyridin-4-ylphenyl]pyridine.
| Compound Name | 4-[2,5-bis[(2S)-2-methylbutoxy]-4-pyridin-4-ylphenyl]pyridine |
|---|---|
| PubChem CID | 102199068 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 4-[2,5-bis[(2S)-2-methylbutoxy]-4-pyridin-4-ylphenyl]pyridine |
| SMILES | CC[C@H](C)COc1cc(-c2ccncc2)c(OC[C@@H](C)CC)cc1-c1ccncc1 |
| InChI | InChI=1S/C26H32N2O2/c1-5-19(3)17-29-25-15-24(22-9-13-28-14-10-22)26(30-18-20(4)6-2)16-23(25)21-7-11-27-12-8-21/h7-16,19-20H,5-6,17-18H2,1-4H3/t19-,20-/m0/s1 |
| InChIKey | SVYDQKGCRZTRGR-PMACEKPBSA-N |
| XLogP | 6.66 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |