C33H25NO2 — CID 102204810
(2S,3Z)-3-[(naphthalen-1-ylmethylamino)methylidene]-2-(4-phenylphenyl)chromen-4-one (PubChem CID 102204810) has the molecular formula C33H25NO2 and a molecular weight of 467.57 g/mol. Its IUPAC name is (2S,3Z)-3-[(naphthalen-1-ylmethylamino)methylidene]-2-(4-phenylphenyl)chromen-4-one.
| Compound Name | (2S,3Z)-3-[(naphthalen-1-ylmethylamino)methylidene]-2-(4-phenylphenyl)chromen-4-one |
|---|---|
| PubChem CID | 102204810 |
| Molecular Formula | C33H25NO2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (2S,3Z)-3-[(naphthalen-1-ylmethylamino)methylidene]-2-(4-phenylphenyl)chromen-4-one |
| SMILES | O=C1/C(=C\NCc2cccc3ccccc23)[C@H](c2ccc(-c3ccccc3)cc2)Oc2ccccc21 |
| InChI | InChI=1S/C33H25NO2/c35-32-29-15-6-7-16-31(29)36-33(26-19-17-24(18-20-26)23-9-2-1-3-10-23)30(32)22-34-21-27-13-8-12-25-11-4-5-14-28(25)27/h1-20,22,33-34H,21H2/b30-22+/t33-/m0/s1 |
| InChIKey | LGCYJKFDNMHBRW-XTGQZIRNSA-N |
| XLogP | 7.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|