C17H14O6 — CID 102208348
6-hydroxy-2-(4-hydroxy-2,5-dimethoxyphenyl)-1-benzofuran-3-carbaldehyde (PubChem CID 102208348) has the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. Its IUPAC name is 6-hydroxy-2-(4-hydroxy-2,5-dimethoxyphenyl)-1-benzofuran-3-carbaldehyde.
| Compound Name | 6-hydroxy-2-(4-hydroxy-2,5-dimethoxyphenyl)-1-benzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 102208348 |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 6-hydroxy-2-(4-hydroxy-2,5-dimethoxyphenyl)-1-benzofuran-3-carbaldehyde |
| SMILES | COc1cc(-c2oc3cc(O)ccc3c2C=O)c(OC)cc1O |
| InChI | InChI=1S/C17H14O6/c1-21-14-7-13(20)16(22-2)6-11(14)17-12(8-18)10-4-3-9(19)5-15(10)23-17/h3-8,19-20H,1-2H3 |
| InChIKey | SVVGZXKQDCEBAU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|