C9H12NS+ — CID 102220622
[4-(2-methylsulfanylethylidene)cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 102220622) has the molecular formula C9H12NS+ and a molecular weight of 166.27 g/mol. Its IUPAC name is [4-(2-methylsulfanylethylidene)cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | [4-(2-methylsulfanylethylidene)cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 102220622 |
| Molecular Formula | C9H12NS+ |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | [4-(2-methylsulfanylethylidene)cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | CSCC=C1C=CC(=[NH2+])C=C1 |
| InChI | InChI=1S/C9H11NS/c1-11-7-6-8-2-4-9(10)5-3-8/h2-6,10H,7H2,1H3/p+1/b8-6-,10-9? |
| InChIKey | VSDRCSHYDKTJAU-DVVHKNHLSA-O |
| XLogP | 0.60 |
| TPSA | 25.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|