C9H11NS — CID 102220623
4-(2-methylsulfanylethylidene)cyclohexa-2,5-dien-1-imine (PubChem CID 102220623) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 4-(2-methylsulfanylethylidene)cyclohexa-2,5-dien-1-imine.
| Compound Name | 4-(2-methylsulfanylethylidene)cyclohexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 102220623 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 4-(2-methylsulfanylethylidene)cyclohexa-2,5-dien-1-imine |
| SMILES | [H]N=C1C=CC(=CCSC)C=C1 |
| InChI | InChI=1S/C9H11NS/c1-11-7-6-8-2-4-9(10)5-3-8/h2-6,10H,7H2,1H3/b8-6-,10-9+ |
| InChIKey | VSDRCSHYDKTJAU-JWJWWGMXSA-N |
| XLogP | 2.42 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|