C16H21N — CID 102221642
(5S,8aS)-5,7-dimethyl-6-phenyl-1,2,3,5,8,8a-hexahydroindolizine (PubChem CID 102221642) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (5S,8aS)-5,7-dimethyl-6-phenyl-1,2,3,5,8,8a-hexahydroindolizine.
| Compound Name | (5S,8aS)-5,7-dimethyl-6-phenyl-1,2,3,5,8,8a-hexahydroindolizine |
|---|---|
| PubChem CID | 102221642 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (5S,8aS)-5,7-dimethyl-6-phenyl-1,2,3,5,8,8a-hexahydroindolizine |
| SMILES | CC1=C(c2ccccc2)[C@H](C)N2CCC[C@H]2C1 |
| InChI | InChI=1S/C16H21N/c1-12-11-15-9-6-10-17(15)13(2)16(12)14-7-4-3-5-8-14/h3-5,7-8,13,15H,6,9-11H2,1-2H3/t13-,15-/m0/s1 |
| InChIKey | OQRXDICNXIIMQQ-ZFWWWQNUSA-N |
| XLogP | 3.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |