C12H15NO2 — CID 102227948
(3S,4S,5R)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde (PubChem CID 102227948) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (3S,4S,5R)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde.
| Compound Name | (3S,4S,5R)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 102227948 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3S,4S,5R)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde |
| SMILES | C[C@H]1ON(C)[C@H](c2ccccc2)[C@@H]1C=O |
| InChI | InChI=1S/C12H15NO2/c1-9-11(8-14)12(13(2)15-9)10-6-4-3-5-7-10/h3-9,11-12H,1-2H3/t9-,11-,12-/m1/s1 |
| InChIKey | KQJTWCMTTFBYMD-YUSALJHKSA-N |
| XLogP | 1.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|