C19H23N3O7 — CID 10222936
(2R)-6-amino-2-[[2-[1-benzofuran-2-carbonyl(carboxymethyl)amino]acetyl]amino]hexanoic acid (PubChem CID 10222936) has the molecular formula C19H23N3O7 and a molecular weight of 405.41 g/mol. Its IUPAC name is (2R)-6-amino-2-[[2-[1-benzofuran-2-carbonyl(carboxymethyl)amino]acetyl]amino]hexanoic acid.
| Compound Name | (2R)-6-amino-2-[[2-[1-benzofuran-2-carbonyl(carboxymethyl)amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 10222936 |
| Molecular Formula | C19H23N3O7 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (2R)-6-amino-2-[[2-[1-benzofuran-2-carbonyl(carboxymethyl)amino]acetyl]amino]hexanoic acid |
| SMILES | NCCCC[C@@H](NC(=O)CN(CC(=O)O)C(=O)c1cc2ccccc2o1)C(=O)O |
| InChI | InChI=1S/C19H23N3O7/c20-8-4-3-6-13(19(27)28)21-16(23)10-22(11-17(24)25)18(26)15-9-12-5-1-2-7-14(12)29-15/h1-2,5,7,9,13H,3-4,6,8,10-11,20H2,(H,21,23)(H,24,25)(H,27,28)/t13-/m1/s1 |
| InChIKey | ODLAHZJTFURYRN-CYBMUJFWSA-N |
| XLogP | 0.66 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|