C36H39N7O11 — CID 100993708
2-[1-benzofuran-2-carbonyl-[2-[[(2S)-5-[bis(2-phenylmethoxycarbonylhydrazinyl)methylideneamino]-1-methoxy-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]acetic acid (PubChem CID 100993708) has the molecular formula C36H39N7O11 and a molecular weight of 745.75 g/mol. Its IUPAC name is 2-[1-benzofuran-2-carbonyl-[2-[[(2S)-5-[bis(2-phenylmethoxycarbonylhydrazinyl)methylideneamino]-1-methoxy-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[1-benzofuran-2-carbonyl-[2-[[(2S)-5-[bis(2-phenylmethoxycarbonylhydrazinyl)methylideneamino]-1-methoxy-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 100993708 |
| Molecular Formula | C36H39N7O11 |
| Molecular Weight | 745.75 g/mol |
| Exact Mass | 745.27 |
| IUPAC Name | 2-[1-benzofuran-2-carbonyl-[2-[[(2S)-5-[bis(2-phenylmethoxycarbonylhydrazinyl)methylideneamino]-1-methoxy-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]acetic acid |
| SMILES | COC(=O)[C@H](CCCN=C(NNC(=O)OCc1ccccc1)NNC(=O)OCc1ccccc1)NC(=O)CN(CC(=O)O)C(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C36H39N7O11/c1-51-33(48)27(38-30(44)20-43(21-31(45)46)32(47)29-19-26-15-8-9-17-28(26)54-29)16-10-18-37-34(39-41-35(49)52-22-24-11-4-2-5-12-24)40-42-36(50)53-23-25-13-6-3-7-14-25/h2-9,11-15,17,19,27H,10,16,18,20-23H2,1H3,(H,38,44)(H,41,49)(H,42,50)(H,45,46)(H2,37,39,40)/t27-/m0/s1 |
| InChIKey | FODKJMYMTZSHBB-MHZLTWQESA-N |
| XLogP | 2.62 |
| TPSA | 239.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|