C14H14N4 — CID 102235005
11,12-dihydrobenzo[c][1,2]benzodiazocine-3,8-diamine (PubChem CID 102235005) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 11,12-dihydrobenzo[c][1,2]benzodiazocine-3,8-diamine.
| Compound Name | 11,12-dihydrobenzo[c][1,2]benzodiazocine-3,8-diamine |
|---|---|
| PubChem CID | 102235005 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 11,12-dihydrobenzo[c][1,2]benzodiazocine-3,8-diamine |
| SMILES | Nc1ccc2c(c1)/N=N\c1cc(N)ccc1CC2 |
| InChI | InChI=1S/C14H14N4/c15-11-5-3-9-1-2-10-4-6-12(16)8-14(10)18-17-13(9)7-11/h3-8H,1-2,15-16H2/b18-17- |
| InChIKey | FHGPHPSXNMNRIR-ZCXUNETKSA-N |
| XLogP | 3.37 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|