C36H33BrO7 — CID 102237097
(1R,4R)-6-bromo-5-methoxy-4,8-bis(phenylmethoxy)-1-(phenylmethoxymethoxy)-1,2,3,4-tetrahydroxanthen-9-one (PubChem CID 102237097) has the molecular formula C36H33BrO7 and a molecular weight of 657.56 g/mol. Its IUPAC name is (1R,4R)-6-bromo-5-methoxy-4,8-bis(phenylmethoxy)-1-(phenylmethoxymethoxy)-1,2,3,4-tetrahydroxanthen-9-one.
| Compound Name | (1R,4R)-6-bromo-5-methoxy-4,8-bis(phenylmethoxy)-1-(phenylmethoxymethoxy)-1,2,3,4-tetrahydroxanthen-9-one |
|---|---|
| PubChem CID | 102237097 |
| Molecular Formula | C36H33BrO7 |
| Molecular Weight | 657.56 g/mol |
| Exact Mass | 656.14 |
| IUPAC Name | (1R,4R)-6-bromo-5-methoxy-4,8-bis(phenylmethoxy)-1-(phenylmethoxymethoxy)-1,2,3,4-tetrahydroxanthen-9-one |
| SMILES | COc1c(Br)cc(OCc2ccccc2)c2c(=O)c3c(oc12)[C@H](OCc1ccccc1)CC[C@H]3OCOCc1ccccc1 |
| InChI | InChI=1S/C36H33BrO7/c1-39-34-27(37)19-30(42-22-26-15-9-4-10-16-26)32-33(38)31-28(43-23-40-20-24-11-5-2-6-12-24)17-18-29(35(31)44-36(32)34)41-21-25-13-7-3-8-14-25/h2-16,19,28-29H,17-18,20-23H2,1H3/t28-,29-/m1/s1 |
| InChIKey | IMVSRRSZKKBNRH-FQLXRVMXSA-N |
| XLogP | 8.43 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.56 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|