C34H27NO4S2 — CID 102237256
8-methyl-12,16-diphenyl-12,16-dithiophen-2-yl-13,14,15-trioxa-8-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6-trien-9-one (PubChem CID 102237256) has the molecular formula C34H27NO4S2 and a molecular weight of 577.73 g/mol. Its IUPAC name is 8-methyl-12,16-diphenyl-12,16-dithiophen-2-yl-13,14,15-trioxa-8-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6-trien-9-one.
| Compound Name | 8-methyl-12,16-diphenyl-12,16-dithiophen-2-yl-13,14,15-trioxa-8-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 102237256 |
| Molecular Formula | C34H27NO4S2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | 8-methyl-12,16-diphenyl-12,16-dithiophen-2-yl-13,14,15-trioxa-8-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6-trien-9-one |
| SMILES | CN1C(=O)C23CC(c4ccccc4)(c4cccs4)OOC2(OC(c2ccccc2)(c2cccs2)C3)c2ccccc21 |
| InChI | InChI=1S/C34H27NO4S2/c1-35-27-17-9-8-16-26(27)34-31(30(35)36,22-32(37-34,28-18-10-20-40-28)24-12-4-2-5-13-24)23-33(38-39-34,29-19-11-21-41-29)25-14-6-3-7-15-25/h2-21H,22-23H2,1H3 |
| InChIKey | ZCPLKNYCBGTQLT-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|