C25H27BrN4O3 — CID 102243600
8-[(4-bromophenyl)methyl]-3-(2-methylpropyl)-1-(2-phenylmethoxyethyl)-7H-purine-2,6-dione (PubChem CID 102243600) has the molecular formula C25H27BrN4O3 and a molecular weight of 511.42 g/mol. Its IUPAC name is 8-[(4-bromophenyl)methyl]-3-(2-methylpropyl)-1-(2-phenylmethoxyethyl)-7H-purine-2,6-dione.
| Compound Name | 8-[(4-bromophenyl)methyl]-3-(2-methylpropyl)-1-(2-phenylmethoxyethyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 102243600 |
| Molecular Formula | C25H27BrN4O3 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 8-[(4-bromophenyl)methyl]-3-(2-methylpropyl)-1-(2-phenylmethoxyethyl)-7H-purine-2,6-dione |
| SMILES | CC(C)Cn1c(=O)n(CCOCc2ccccc2)c(=O)c2[nH]c(Cc3ccc(Br)cc3)nc21 |
| InChI | InChI=1S/C25H27BrN4O3/c1-17(2)15-30-23-22(27-21(28-23)14-18-8-10-20(26)11-9-18)24(31)29(25(30)32)12-13-33-16-19-6-4-3-5-7-19/h3-11,17H,12-16H2,1-2H3,(H,27,28) |
| InChIKey | JWMCIHFENIOLHZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|