C12H14O5 — CID 102244395
dimethyl (1S,2S,5S)-4-ethynyl-5-hydroxycyclohex-3-ene-1,2-dicarboxylate (PubChem CID 102244395) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is dimethyl (1S,2S,5S)-4-ethynyl-5-hydroxycyclohex-3-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1S,2S,5S)-4-ethynyl-5-hydroxycyclohex-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102244395 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | dimethyl (1S,2S,5S)-4-ethynyl-5-hydroxycyclohex-3-ene-1,2-dicarboxylate |
| SMILES | C#CC1=C[C@H](C(=O)OC)[C@@H](C(=O)OC)C[C@@H]1O |
| InChI | InChI=1S/C12H14O5/c1-4-7-5-8(11(14)16-2)9(6-10(7)13)12(15)17-3/h1,5,8-10,13H,6H2,2-3H3/t8-,9-,10-/m0/s1 |
| InChIKey | IZCLDTZFLWIHSM-GUBZILKMSA-N |
| XLogP | -0.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|