C34H31BrO7 — CID 102245632
[(1R,2S,3R,4R,5S)-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl] 2-bromobenzoate (PubChem CID 102245632) has the molecular formula C34H31BrO7 and a molecular weight of 631.52 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5S)-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl] 2-bromobenzoate.
| Compound Name | [(1R,2S,3R,4R,5S)-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl] 2-bromobenzoate |
|---|---|
| PubChem CID | 102245632 |
| Molecular Formula | C34H31BrO7 |
| Molecular Weight | 631.52 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | [(1R,2S,3R,4R,5S)-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl] 2-bromobenzoate |
| SMILES | O=C(O[C@@]12CO[C@@H](O1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]2OCc1ccccc1)c1ccccc1Br |
| InChI | InChI=1S/C34H31BrO7/c35-28-19-11-10-18-27(28)32(36)41-34-23-40-33(42-34)30(38-21-25-14-6-2-7-15-25)29(37-20-24-12-4-1-5-13-24)31(34)39-22-26-16-8-3-9-17-26/h1-19,29-31,33H,20-23H2/t29-,30-,31+,33+,34+/m1/s1 |
| InChIKey | PBIIAEHZOZHDNL-RITFSESDSA-N |
| XLogP | 6.44 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |