C33H48N2O7S — CID 102246939
tert-butyl 2-[methyl-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 102246939) has the molecular formula C33H48N2O7S and a molecular weight of 616.82 g/mol. Its IUPAC name is tert-butyl 2-[methyl-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | tert-butyl 2-[methyl-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 102246939 |
| Molecular Formula | C33H48N2O7S |
| Molecular Weight | 616.82 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | tert-butyl 2-[methyl-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | Cc1c(C)c(S(=O)(=O)N(C)C(CCCCNC(=O)OCc2ccccc2)C(=O)OC(C)(C)C)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C33H48N2O7S/c1-22-23(2)29(24(3)26-18-19-33(7,8)41-28(22)26)43(38,39)35(9)27(30(36)42-32(4,5)6)17-13-14-20-34-31(37)40-21-25-15-11-10-12-16-25/h10-12,15-16,27H,13-14,17-21H2,1-9H3,(H,34,37) |
| InChIKey | XGVYTDUJGQYIOC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.82 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|