C17H17N3O5S — CID 102258791
(4R,5S)-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1'-methyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one (PubChem CID 102258791) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is (4R,5S)-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1'-methyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one.
| Compound Name | (4R,5S)-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1'-methyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one |
|---|---|
| PubChem CID | 102258791 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (4R,5S)-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1'-methyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one |
| SMILES | CN1C(=O)[C@]2(OC(=S)N[C@H]2C(=O)N2C(=O)OCC2(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H17N3O5S/c1-16(2)8-24-15(23)20(16)12(21)11-17(25-14(26)18-11)9-6-4-5-7-10(9)19(3)13(17)22/h4-7,11H,8H2,1-3H3,(H,18,26)/t11-,17-/m0/s1 |
| InChIKey | ZDXQMKPOALVACP-GTNSWQLSSA-N |
| XLogP | 0.89 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|