C24H25N3O4S — CID 10225930
5-[4-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethyl]anilino]-1,3-thiazolidine-2,4-dione (PubChem CID 10225930) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is 5-[4-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethyl]anilino]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[4-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethyl]anilino]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10225930 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 5-[4-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethyl]anilino]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Nc2ccc(CCNCC(O)COc3cccc4ccccc34)cc2)S1 |
| InChI | InChI=1S/C24H25N3O4S/c28-19(15-31-21-7-3-5-17-4-1-2-6-20(17)21)14-25-13-12-16-8-10-18(11-9-16)26-23-22(29)27-24(30)32-23/h1-11,19,23,25-26,28H,12-15H2,(H,27,29,30) |
| InChIKey | XEPWEBSGALYHAC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|