C11H15OPS — CID 102267837
2-[(2S)-1,3,4-trimethyl-1-sulfido-2,5-dihydrophosphol-1-ium-2-yl]furan (PubChem CID 102267837) has the molecular formula C11H15OPS and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-[(2S)-1,3,4-trimethyl-1-sulfido-2,5-dihydrophosphol-1-ium-2-yl]furan.
| Compound Name | 2-[(2S)-1,3,4-trimethyl-1-sulfido-2,5-dihydrophosphol-1-ium-2-yl]furan |
|---|---|
| PubChem CID | 102267837 |
| Molecular Formula | C11H15OPS |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-[(2S)-1,3,4-trimethyl-1-sulfido-2,5-dihydrophosphol-1-ium-2-yl]furan |
| SMILES | CC1=C(C)[C@@H](c2ccco2)[P+](C)([S-])C1 |
| InChI | InChI=1S/C11H15OPS/c1-8-7-13(3,14)11(9(8)2)10-5-4-6-12-10/h4-6,11H,7H2,1-3H3/t11-,13?/m0/s1 |
| InChIKey | YPGSBWJLAAVJIG-AMGKYWFPSA-N |
| XLogP | 3.78 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|