C20H25NO7 — CID 102268013
(2S)-2-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-(4-methoxyanilino)methyl]-2H-furan-5-one (PubChem CID 102268013) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is (2S)-2-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-(4-methoxyanilino)methyl]-2H-furan-5-one.
| Compound Name | (2S)-2-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-(4-methoxyanilino)methyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 102268013 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (2S)-2-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-(4-methoxyanilino)methyl]-2H-furan-5-one |
| SMILES | COc1ccc(NC([C@@H]2C=CC(=O)O2)[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OC)cc1 |
| InChI | InChI=1S/C20H25NO7/c1-20(2)27-18-17(24-4)16(26-19(18)28-20)15(13-9-10-14(22)25-13)21-11-5-7-12(23-3)8-6-11/h5-10,13,15-19,21H,1-4H3/t13-,15?,16+,17-,18+,19+/m0/s1 |
| InChIKey | FIYMJXBICDSYAV-HJFJUSSOSA-N |
| XLogP | 1.85 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|