C16H13BrO — CID 102268825
(10Z)-7-bromotricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,10,12,14-heptaen-2-ol (PubChem CID 102268825) has the molecular formula C16H13BrO and a molecular weight of 301.18 g/mol. Its IUPAC name is (10Z)-7-bromotricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,10,12,14-heptaen-2-ol.
| Compound Name | (10Z)-7-bromotricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,10,12,14-heptaen-2-ol |
|---|---|
| PubChem CID | 102268825 |
| Molecular Formula | C16H13BrO |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | (10Z)-7-bromotricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,10,12,14-heptaen-2-ol |
| SMILES | OC1Cc2ccc(Br)cc2/C=C\c2ccccc21 |
| InChI | InChI=1S/C16H13BrO/c17-14-8-7-13-10-16(18)15-4-2-1-3-11(15)5-6-12(13)9-14/h1-9,16,18H,10H2/b6-5- |
| InChIKey | SQKJCWUMVDDOPB-WAYWQWQTSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|