C9H18O2 — CID 102271186
(3R)-2-(hydroxymethyl)-3,5-dimethylhexanal (PubChem CID 102271186) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (3R)-2-(hydroxymethyl)-3,5-dimethylhexanal.
| Compound Name | (3R)-2-(hydroxymethyl)-3,5-dimethylhexanal |
|---|---|
| PubChem CID | 102271186 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (3R)-2-(hydroxymethyl)-3,5-dimethylhexanal |
| SMILES | CC(C)C[C@@H](C)C(C=O)CO |
| InChI | InChI=1S/C9H18O2/c1-7(2)4-8(3)9(5-10)6-11/h5,7-9,11H,4,6H2,1-3H3/t8-,9?/m1/s1 |
| InChIKey | YMTSWENGAKCOLK-VEDVMXKPSA-N |
| XLogP | 1.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|