About (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide
(3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide (PubChem CID 57191637) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide.
Molecular Properties
| Compound Name | (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide |
| PubChem CID | 57191637 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide |
| SMILES | CC(C)C[C@@H](C=O)C(C)C(=O)NO |
| InChI | InChI=1S/C9H17NO3/c1-6(2)4-8(5-11)7(3)9(12)10-13/h5-8,13H,4H2,1-3H3,(H,10,12)/t7?,8-/m0/s1 |
| InChIKey | OUCSOYBZJGAKAY-MQWKRIRWSA-N |
| XLogP | 0.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide?
The IUPAC name of (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide (CID 57191637) is (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide.
What is the SMILES notation for (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide?
The canonical SMILES for (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide is CC(C)C[C@@H](C=O)C(C)C(=O)NO.
What is the InChIKey of (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide?
The InChIKey is OUCSOYBZJGAKAY-MQWKRIRWSA-N. The full InChI is InChI=1S/C9H17NO3/c1-6(2)4-8(5-11)7(3)9(12)10-13/h5-8,13H,4H2,1-3H3,(H,10,12)/t7?,8-/m0/s1.
What are the key properties of (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide?
(3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide has a molecular weight of 187.24 g/mol, XLogP of 0.99, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-formyl-N-hydroxy-2,5-dimethylhexanamide is sourced from PubChem (CID 57191637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).