C38H56O4Si2 — CID 102271694
(1R,2S,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(furan-2-yl)-2,5-dimethylcyclohex-3-en-1-ol (PubChem CID 102271694) has the molecular formula C38H56O4Si2 and a molecular weight of 633.03 g/mol. Its IUPAC name is (1R,2S,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(furan-2-yl)-2,5-dimethylcyclohex-3-en-1-ol.
| Compound Name | (1R,2S,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(furan-2-yl)-2,5-dimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 102271694 |
| Molecular Formula | C38H56O4Si2 |
| Molecular Weight | 633.03 g/mol |
| Exact Mass | 632.37 |
| IUPAC Name | (1R,2S,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(furan-2-yl)-2,5-dimethylcyclohex-3-en-1-ol |
| SMILES | C[C@H]1C[C@](O)(c2ccco2)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)C=C1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H56O4Si2/c1-30-27-38(39,34-23-17-25-40-34)37(8,24-18-26-41-43(9,10)35(2,3)4)28-31(30)29-42-44(36(5,6)7,32-19-13-11-14-20-32)33-21-15-12-16-22-33/h11-17,19-23,25,28,30,39H,18,24,26-27,29H2,1-10H3/t30-,37-,38-/m0/s1 |
| InChIKey | ZZXFDJQTZTZBHC-NWGFZFNUSA-N |
| XLogP | 8.82 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.03 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|