C30H46BrNO3Si2 — CID 23726865
(3S,5S)-3-bromo-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one (PubChem CID 23726865) has the molecular formula C30H46BrNO3Si2 and a molecular weight of 604.78 g/mol. Its IUPAC name is (3S,5S)-3-bromo-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one.
| Compound Name | (3S,5S)-3-bromo-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 23726865 |
| Molecular Formula | C30H46BrNO3Si2 |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | (3S,5S)-3-bromo-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@]1(Br)C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)NC1=O |
| InChI | InChI=1S/C30H46BrNO3Si2/c1-28(2,3)36(7,8)34-21-15-20-30(31)22-24(32-27(30)33)23-35-37(29(4,5)6,25-16-11-9-12-17-25)26-18-13-10-14-19-26/h9-14,16-19,24H,15,20-23H2,1-8H3,(H,32,33)/t24-,30-/m0/s1 |
| InChIKey | FIXJUARMWSJIHF-NGQVCNFZSA-N |
| XLogP | 6.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|