C40H60O5Si2 — CID 101463337
tert-butyl-[6-[[(8S,9R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-7-yl]methoxy]hex-4-ynoxy]-diphenylsilane (PubChem CID 101463337) has the molecular formula C40H60O5Si2 and a molecular weight of 677.09 g/mol. Its IUPAC name is tert-butyl-[6-[[(8S,9R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-7-yl]methoxy]hex-4-ynoxy]-diphenylsilane.
| Compound Name | tert-butyl-[6-[[(8S,9R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-7-yl]methoxy]hex-4-ynoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101463337 |
| Molecular Formula | C40H60O5Si2 |
| Molecular Weight | 677.09 g/mol |
| Exact Mass | 676.40 |
| IUPAC Name | tert-butyl-[6-[[(8S,9R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-7-yl]methoxy]hex-4-ynoxy]-diphenylsilane |
| SMILES | C[C@@H]1CC2(C=C(COCC#CCCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@]1(C)CO[Si](C)(C)C(C)(C)C)OCCO2 |
| InChI | InChI=1S/C40H60O5Si2/c1-33-29-40(42-27-28-43-40)30-34(39(33,8)32-45-46(9,10)37(2,3)4)31-41-25-19-11-12-20-26-44-47(38(5,6)7,35-21-15-13-16-22-35)36-23-17-14-18-24-36/h13-18,21-24,30,33H,12,20,25-29,31-32H2,1-10H3/t33-,39+/m1/s1 |
| InChIKey | DEFWWWKPAATLDG-GDYKHXCGSA-N |
| XLogP | 8.10 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.09 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|