C30H28N2O4 — CID 102278982
ethyl (8E)-10-benzyl-5,11-dioxo-7-phenyl-2,10-diazatricyclo[10.4.0.02,6]hexadeca-1(16),8,12,14-tetraene-6-carboxylate (PubChem CID 102278982) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is ethyl (8E)-10-benzyl-5,11-dioxo-7-phenyl-2,10-diazatricyclo[10.4.0.02,6]hexadeca-1(16),8,12,14-tetraene-6-carboxylate.
| Compound Name | ethyl (8E)-10-benzyl-5,11-dioxo-7-phenyl-2,10-diazatricyclo[10.4.0.02,6]hexadeca-1(16),8,12,14-tetraene-6-carboxylate |
|---|---|
| PubChem CID | 102278982 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | ethyl (8E)-10-benzyl-5,11-dioxo-7-phenyl-2,10-diazatricyclo[10.4.0.02,6]hexadeca-1(16),8,12,14-tetraene-6-carboxylate |
| SMILES | CCOC(=O)C12C(=O)CCN1c1ccccc1C(=O)N(Cc1ccccc1)/C=C/C2c1ccccc1 |
| InChI | InChI=1S/C30H28N2O4/c1-2-36-29(35)30-25(23-13-7-4-8-14-23)17-19-31(21-22-11-5-3-6-12-22)28(34)24-15-9-10-16-26(24)32(30)20-18-27(30)33/h3-17,19,25H,2,18,20-21H2,1H3/b19-17+ |
| InChIKey | RQBSIOKCDBPQHL-HTXNQAPBSA-N |
| XLogP | 4.72 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|