C29H28N2O5S — CID 102281212
prop-2-enyl 4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-(2-sulfanylethyl)amino]benzoate (PubChem CID 102281212) has the molecular formula C29H28N2O5S and a molecular weight of 516.62 g/mol. Its IUPAC name is prop-2-enyl 4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-(2-sulfanylethyl)amino]benzoate.
| Compound Name | prop-2-enyl 4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-(2-sulfanylethyl)amino]benzoate |
|---|---|
| PubChem CID | 102281212 |
| Molecular Formula | C29H28N2O5S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | prop-2-enyl 4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-(2-sulfanylethyl)amino]benzoate |
| SMILES | C=CCOC(=O)c1ccc(N(CCS)C(=O)CNC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C29H28N2O5S/c1-2-16-35-28(33)20-11-13-21(14-12-20)31(15-17-37)27(32)18-30-29(34)36-19-26-24-9-5-3-7-22(24)23-8-4-6-10-25(23)26/h2-14,26,37H,1,15-19H2,(H,30,34) |
| InChIKey | OGVBHQMOCGNGPP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|