C70H61N3O6S — CID 71490232
prop-2-enyl 4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoyl]-(2-tritylsulfanylethyl)amino]benzoate (PubChem CID 71490232) has the molecular formula C70H61N3O6S and a molecular weight of 1072.34 g/mol. Its IUPAC name is prop-2-enyl 4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoyl]-(2-tritylsulfanylethyl)amino]benzoate.
| Compound Name | prop-2-enyl 4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoyl]-(2-tritylsulfanylethyl)amino]benzoate |
|---|---|
| PubChem CID | 71490232 |
| Molecular Formula | C70H61N3O6S |
| Molecular Weight | 1072.34 g/mol |
| Exact Mass | 1071.43 |
| IUPAC Name | prop-2-enyl 4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoyl]-(2-tritylsulfanylethyl)amino]benzoate |
| SMILES | C=CCOC(=O)c1ccc(N(CCSC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)[C@H](CCC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C70H61N3O6S/c1-2-48-78-67(76)51-41-43-58(44-42-51)73(47-49-80-70(55-31-15-6-16-32-55,56-33-17-7-18-34-56)57-35-19-8-20-36-57)66(75)64(71-68(77)79-50-63-61-39-23-21-37-59(61)60-38-22-24-40-62(60)63)45-46-65(74)72-69(52-25-9-3-10-26-52,53-27-11-4-12-28-53)54-29-13-5-14-30-54/h2-44,63-64H,1,45-50H2,(H,71,77)(H,72,74)/t64-/m0/s1 |
| InChIKey | XQHBBMHJQGMVRZ-JVUALNACSA-N |
| XLogP | 13.88 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1072.34 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|