C21H40O4Si — CID 102286144
7-[tert-butyl(dimethyl)silyl]oxydec-9-enyl (3S)-3-hydroxypent-4-enoate (PubChem CID 102286144) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxydec-9-enyl (3S)-3-hydroxypent-4-enoate.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxydec-9-enyl (3S)-3-hydroxypent-4-enoate |
|---|---|
| PubChem CID | 102286144 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxydec-9-enyl (3S)-3-hydroxypent-4-enoate |
| SMILES | C=CCC(CCCCCCOC(=O)C[C@H](O)C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O4Si/c1-8-14-19(25-26(6,7)21(3,4)5)15-12-10-11-13-16-24-20(23)17-18(22)9-2/h8-9,18-19,22H,1-2,10-17H2,3-7H3/t18-,19?/m1/s1 |
| InChIKey | KEWNMQWLUVNMCV-MRTLOADZSA-N |
| XLogP | 5.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|