C22H42O4Si — CID 46919830
(3R,4R,5E)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-1-oxacyclohexadec-5-en-2-one (PubChem CID 46919830) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is (3R,4R,5E)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-1-oxacyclohexadec-5-en-2-one.
| Compound Name | (3R,4R,5E)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-1-oxacyclohexadec-5-en-2-one |
|---|---|
| PubChem CID | 46919830 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (3R,4R,5E)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-1-oxacyclohexadec-5-en-2-one |
| SMILES | C[C@H]1C(=O)OCCCCCCCCC(O[Si](C)(C)C(C)(C)C)C/C=C/[C@H]1O |
| InChI | InChI=1S/C22H42O4Si/c1-18-20(23)16-13-15-19(26-27(5,6)22(2,3)4)14-11-9-7-8-10-12-17-25-21(18)24/h13,16,18-20,23H,7-12,14-15,17H2,1-6H3/b16-13+/t18-,19?,20-/m1/s1 |
| InChIKey | SOHXHYGUJWMUSO-CSWIZMOXSA-N |
| XLogP | 5.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|