C17H28O5 — CID 162868137
[(2R,3S,8R,9R)-8-hydroxy-9-methyl-10-oxo-2-pentyl-2,3,4,5,8,9-hexahydrooxecin-3-yl] acetate (PubChem CID 162868137) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(2R,3S,8R,9R)-8-hydroxy-9-methyl-10-oxo-2-pentyl-2,3,4,5,8,9-hexahydrooxecin-3-yl] acetate.
| Compound Name | [(2R,3S,8R,9R)-8-hydroxy-9-methyl-10-oxo-2-pentyl-2,3,4,5,8,9-hexahydrooxecin-3-yl] acetate |
|---|---|
| PubChem CID | 162868137 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(2R,3S,8R,9R)-8-hydroxy-9-methyl-10-oxo-2-pentyl-2,3,4,5,8,9-hexahydrooxecin-3-yl] acetate |
| SMILES | CCCCC[C@H]1OC(=O)[C@H](C)[C@H](O)C=CCC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H28O5/c1-4-5-6-10-16-15(21-13(3)18)11-8-7-9-14(19)12(2)17(20)22-16/h7,9,12,14-16,19H,4-6,8,10-11H2,1-3H3/t12-,14-,15+,16-/m1/s1 |
| InChIKey | QHXMFFURBASZNH-DMRZNYOFSA-N |
| XLogP | 2.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|