C26H50O4Si — CID 71665639
[(3S,6S)-3-hydroxypentadec-1-en-6-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate (PubChem CID 71665639) has the molecular formula C26H50O4Si and a molecular weight of 454.77 g/mol. Its IUPAC name is [(3S,6S)-3-hydroxypentadec-1-en-6-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate.
| Compound Name | [(3S,6S)-3-hydroxypentadec-1-en-6-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
|---|---|
| PubChem CID | 71665639 |
| Molecular Formula | C26H50O4Si |
| Molecular Weight | 454.77 g/mol |
| Exact Mass | 454.35 |
| IUPAC Name | [(3S,6S)-3-hydroxypentadec-1-en-6-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
| SMILES | C=C[C@@H](O)CC[C@H](CCCCCCCCC)OC(=O)C[C@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O4Si/c1-9-12-13-14-15-16-17-18-24(20-19-22(27)10-2)29-25(28)21-23(11-3)30-31(7,8)26(4,5)6/h10-11,22-24,27H,2-3,9,12-21H2,1,4-8H3/t22-,23+,24+/m1/s1 |
| InChIKey | UIEHVINIGOVDLR-SGNDLWITSA-N |
| XLogP | 7.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.77 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|