C29H30O6 — CID 102307924
(2S,3R,4S,4aS,6R,8aS)-2-methoxy-6-phenyl-3,4-bis(phenylmethoxy)-3,4,4a,6,7,8a-hexahydro-2H-pyrano[3,2-b]pyran-8-one (PubChem CID 102307924) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is (2S,3R,4S,4aS,6R,8aS)-2-methoxy-6-phenyl-3,4-bis(phenylmethoxy)-3,4,4a,6,7,8a-hexahydro-2H-pyrano[3,2-b]pyran-8-one.
| Compound Name | (2S,3R,4S,4aS,6R,8aS)-2-methoxy-6-phenyl-3,4-bis(phenylmethoxy)-3,4,4a,6,7,8a-hexahydro-2H-pyrano[3,2-b]pyran-8-one |
|---|---|
| PubChem CID | 102307924 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | (2S,3R,4S,4aS,6R,8aS)-2-methoxy-6-phenyl-3,4-bis(phenylmethoxy)-3,4,4a,6,7,8a-hexahydro-2H-pyrano[3,2-b]pyran-8-one |
| SMILES | CO[C@H]1O[C@@H]2C(=O)C[C@H](c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H30O6/c1-31-29-28(33-19-21-13-7-3-8-14-21)26(32-18-20-11-5-2-6-12-20)27-25(35-29)23(30)17-24(34-27)22-15-9-4-10-16-22/h2-16,24-29H,17-19H2,1H3/t24-,25-,26+,27-,28?,29+/m1/s1 |
| InChIKey | YRMDVCHKHFZIQN-ICHYBAGLSA-N |
| XLogP | 4.63 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |