C18H17N3O4 — CID 102314695
methyl (E)-3-[[1-[(1S)-1-hydroxyethyl]-9H-pyrido[3,4-b]indole-3-carbonyl]amino]prop-2-enoate (PubChem CID 102314695) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is methyl (E)-3-[[1-[(1S)-1-hydroxyethyl]-9H-pyrido[3,4-b]indole-3-carbonyl]amino]prop-2-enoate.
| Compound Name | methyl (E)-3-[[1-[(1S)-1-hydroxyethyl]-9H-pyrido[3,4-b]indole-3-carbonyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 102314695 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | methyl (E)-3-[[1-[(1S)-1-hydroxyethyl]-9H-pyrido[3,4-b]indole-3-carbonyl]amino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NC(=O)c1cc2c([nH]c3ccccc32)c([C@H](C)O)n1 |
| InChI | InChI=1S/C18H17N3O4/c1-10(22)16-17-12(11-5-3-4-6-13(11)20-17)9-14(21-16)18(24)19-8-7-15(23)25-2/h3-10,20,22H,1-2H3,(H,19,24)/b8-7+/t10-/m0/s1 |
| InChIKey | WZPSGPNOBZBZCX-JARNTUPDSA-N |
| XLogP | 2.19 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|