C11H12ClN5O2 — CID 102315638
N-(6-chloro-4-oxopteridin-3-yl)-2,2-dimethylpropanamide (PubChem CID 102315638) has the molecular formula C11H12ClN5O2 and a molecular weight of 281.70 g/mol. Its IUPAC name is N-(6-chloro-4-oxopteridin-3-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(6-chloro-4-oxopteridin-3-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 102315638 |
| Molecular Formula | C11H12ClN5O2 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-(6-chloro-4-oxopteridin-3-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nn1cnc2ncc(Cl)nc2c1=O |
| InChI | InChI=1S/C11H12ClN5O2/c1-11(2,3)10(19)16-17-5-14-8-7(9(17)18)15-6(12)4-13-8/h4-5H,1-3H3,(H,16,19) |
| InChIKey | LYBXPRVPGYODMX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |