C12H5Cl3S2 — CID 102325035
2,3,7-trichlorothianthrene (PubChem CID 102325035) has the molecular formula C12H5Cl3S2 and a molecular weight of 319.67 g/mol. Its IUPAC name is 2,3,7-trichlorothianthrene.
| Compound Name | 2,3,7-trichlorothianthrene |
|---|---|
| PubChem CID | 102325035 |
| Molecular Formula | C12H5Cl3S2 |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 317.89 |
| IUPAC Name | 2,3,7-trichlorothianthrene |
| SMILES | Clc1ccc2c(c1)Sc1cc(Cl)c(Cl)cc1S2 |
| InChI | InChI=1S/C12H5Cl3S2/c13-6-1-2-9-10(3-6)17-12-5-8(15)7(14)4-11(12)16-9/h1-5H |
| InChIKey | IRGNVDXPRGXVII-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |