C29H28N6O7S — CID 10232506
1-(2,4-dimethoxyphenyl)-N-hydroxy-4-[(4-methoxyphenyl)sulfonylmethyl-pyridin-3-ylamino]-3-methylpyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 10232506) has the molecular formula C29H28N6O7S and a molecular weight of 604.65 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-N-hydroxy-4-[(4-methoxyphenyl)sulfonylmethyl-pyridin-3-ylamino]-3-methylpyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 1-(2,4-dimethoxyphenyl)-N-hydroxy-4-[(4-methoxyphenyl)sulfonylmethyl-pyridin-3-ylamino]-3-methylpyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 10232506 |
| Molecular Formula | C29H28N6O7S |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-N-hydroxy-4-[(4-methoxyphenyl)sulfonylmethyl-pyridin-3-ylamino]-3-methylpyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)CN(c2cccnc2)c2c(C(=O)NO)cnc3c2c(C)nn3-c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C29H28N6O7S/c1-18-26-27(34(19-6-5-13-30-15-19)17-43(38,39)22-10-7-20(40-2)8-11-22)23(29(36)33-37)16-31-28(26)35(32-18)24-12-9-21(41-3)14-25(24)42-4/h5-16,37H,17H2,1-4H3,(H,33,36) |
| InChIKey | SDCCSPTUZFGRRE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 158.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|