C18H20O5 — CID 102326070
dimethyl (1R,5R,6R)-5-phenyl-4-oxatricyclo[4.3.0.01,3]nonane-8,8-dicarboxylate (PubChem CID 102326070) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is dimethyl (1R,5R,6R)-5-phenyl-4-oxatricyclo[4.3.0.01,3]nonane-8,8-dicarboxylate.
| Compound Name | dimethyl (1R,5R,6R)-5-phenyl-4-oxatricyclo[4.3.0.01,3]nonane-8,8-dicarboxylate |
|---|---|
| PubChem CID | 102326070 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | dimethyl (1R,5R,6R)-5-phenyl-4-oxatricyclo[4.3.0.01,3]nonane-8,8-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2[C@H](c3ccccc3)OC3C[C@@]32C1 |
| InChI | InChI=1S/C18H20O5/c1-21-15(19)18(16(20)22-2)8-12-14(11-6-4-3-5-7-11)23-13-9-17(12,13)10-18/h3-7,12-14H,8-10H2,1-2H3/t12-,13?,14-,17-/m0/s1 |
| InChIKey | ZQXBHSOMSWPCIE-RYVMGNQUSA-N |
| XLogP | 2.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|