C13H18O4 — CID 102328957
ethyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate (PubChem CID 102328957) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is ethyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate.
| Compound Name | ethyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate |
|---|---|
| PubChem CID | 102328957 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | ethyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate |
| SMILES | CCOC(=O)C12CC3CCCC3(CCC1=O)O2 |
| InChI | InChI=1S/C13H18O4/c1-2-16-11(15)13-8-9-4-3-6-12(9,17-13)7-5-10(13)14/h9H,2-8H2,1H3 |
| InChIKey | JVXVIRACVOKZFK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|