C26H35O6P — CID 102337229
2-[(2R,3R,4S)-6-di(propan-2-yloxy)phosphoryl-3-(4-methoxyphenyl)-4-phenyl-3,4-dihydro-2H-pyran-2-yl]ethanol (PubChem CID 102337229) has the molecular formula C26H35O6P and a molecular weight of 474.53 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-6-di(propan-2-yloxy)phosphoryl-3-(4-methoxyphenyl)-4-phenyl-3,4-dihydro-2H-pyran-2-yl]ethanol.
| Compound Name | 2-[(2R,3R,4S)-6-di(propan-2-yloxy)phosphoryl-3-(4-methoxyphenyl)-4-phenyl-3,4-dihydro-2H-pyran-2-yl]ethanol |
|---|---|
| PubChem CID | 102337229 |
| Molecular Formula | C26H35O6P |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 2-[(2R,3R,4S)-6-di(propan-2-yloxy)phosphoryl-3-(4-methoxyphenyl)-4-phenyl-3,4-dihydro-2H-pyran-2-yl]ethanol |
| SMILES | COc1ccc([C@@H]2[C@@H](CCO)OC(P(=O)(OC(C)C)OC(C)C)=C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H35O6P/c1-18(2)31-33(28,32-19(3)4)25-17-23(20-9-7-6-8-10-20)26(24(30-25)15-16-27)21-11-13-22(29-5)14-12-21/h6-14,17-19,23-24,26-27H,15-16H2,1-5H3/t23-,24+,26-/m0/s1 |
| InChIKey | KKLPINHGYAJVOC-GSLIJJQTSA-N |
| XLogP | 6.23 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|