C22H26F12O2 — CID 102342844
1,4-ditert-butyl-2,5-bis(2,2,3,4,4,4-hexafluorobutoxy)benzene (PubChem CID 102342844) has the molecular formula C22H26F12O2 and a molecular weight of 550.42 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,5-bis(2,2,3,4,4,4-hexafluorobutoxy)benzene.
| Compound Name | 1,4-ditert-butyl-2,5-bis(2,2,3,4,4,4-hexafluorobutoxy)benzene |
|---|---|
| PubChem CID | 102342844 |
| Molecular Formula | C22H26F12O2 |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 1,4-ditert-butyl-2,5-bis(2,2,3,4,4,4-hexafluorobutoxy)benzene |
| SMILES | CC(C)(C)c1cc(OCC(F)(F)C(F)C(F)(F)F)c(C(C)(C)C)cc1OCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C22H26F12O2/c1-17(2,3)11-7-14(36-10-20(27,28)16(24)22(32,33)34)12(18(4,5)6)8-13(11)35-9-19(25,26)15(23)21(29,30)31/h7-8,15-16H,9-10H2,1-6H3 |
| InChIKey | UKNPJXWPWBOWAE-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |